cas: 1349199-61-6 — see every product listed under this CAS number, including other names
TERT-BUTYL 3-OXO-1-OXA-6-AZASPIRO[3.3]HEPTANE-6-CARBOXYLATE, 97% (CAS 1349199-61-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303800-100MG |
| cas | 1349199-61-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2543.91 Pln | |
| Fluorochem | 250mg | 4199.58 Pln | |
| Fluorochem | 500mg | 7641.08 Pln | |
| Fluorochem | 1g | 11410.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-oxo-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate (CAS 1349199-61-6) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: tert-butyl 3-oxo-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate. InChIKey: OIFFGPWHSKSMTM-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | tert-butyl 3-oxo-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate |
| InChIKey | OIFFGPWHSKSMTM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(=O)CO2 |
Computed by PubChem (NCBI)