Products 890709-66-7

CAS 890709-66-7 is the registry number for (S)-2-Methyl-3,5-dioxo-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl (2S)-2-methyl-3,5-dioxopyrrolidine-1-carboxylate (CAS 890709-66-7) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: tert-butyl (2S)-2-methyl-3,5-dioxopyrrolidine-1-carboxylate. InChIKey: XLXSMICXDWTYCA-LURJTMIESA-N.

Identity
Molecular formulaC10H15NO4
Molecular weight213.23 g/mol
IUPAC nametert-butyl (2S)-2-methyl-3,5-dioxopyrrolidine-1-carboxylate
InChIKeyXLXSMICXDWTYCA-LURJTMIESA-N
SMILESC[C@H]1C(=O)CC(=O)N1C(=O)OC(C)(C)C

Computed by PubChem (NCBI)