cas: 169206-67-1 — see every product listed under this CAS number, including other names
TERT-BUTYL 3-OXO-2,8-DIAZASPIRO[4.5]DECANE-8-CARBOXYLATE, 98%, 98% (CAS 169206-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112YL8-100mg |
| cas | 169206-67-1 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1710.80 Pln | |
| Chemat | 50g | 2747.60 Pln | |
| Chemat | 100g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate (CAS 169206-67-1) is a chemical compound with the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. IUPAC name: tert-butyl 3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate. InChIKey: HNMWIKVFYHYBKX-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O3 |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | tert-butyl 3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| InChIKey | HNMWIKVFYHYBKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)NC2 |
Computed by PubChem (NCBI)