cas: 169206-67-1 — see every product listed under this CAS number, including other names
tert-Butyl 3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate 97% (CAS 169206-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109926-100mg |
| cas | 169206-67-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 609.56 Pln | |
| Ambeed | 25g | 2584.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A109926 |
Tert-butyl 3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate (CAS 169206-67-1) is a chemical compound with the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. IUPAC name: tert-butyl 3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate. InChIKey: HNMWIKVFYHYBKX-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O3 |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | tert-butyl 3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| InChIKey | HNMWIKVFYHYBKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)NC2 |
Computed by PubChem (NCBI)