cas: 77278-44-5 — see every product listed under this CAS number, including other names
TERT-BUTYL 4-(4-HYDROXYBENZYL)PIPERAZINE-1-CARBOXYLATE, 95% (CAS 77278-44-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F474680-250MG |
| cas | 77278-44-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 5g | 2372.10 Pln | |
| Fluorochem | 10g | 4006.94 Pln | |
| Fluorochem | 25g | 8573.04 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-[(4-hydroxyphenyl)methyl]piperazine-1-carboxylate (CAS 77278-44-5) is a chemical compound with the molecular formula C16H24N2O3 and a molecular weight of 292.37 g/mol. IUPAC name: tert-butyl 4-[(4-hydroxyphenyl)methyl]piperazine-1-carboxylate. InChIKey: MHCKQOSVLILWQH-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O3 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | tert-butyl 4-[(4-hydroxyphenyl)methyl]piperazine-1-carboxylate |
| InChIKey | MHCKQOSVLILWQH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)