CAS 138026-89-8 appears in our catalog under these names: Trans-3-benzylamino-4-hydroxy-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%, trans-tert-Butyl 3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate 97%, trans-tert-Butyl 3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
Tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate (CAS 138026-89-8) is a chemical compound with the molecular formula C16H24N2O3 and a molecular weight of 292.37 g/mol. IUPAC name: tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate. InChIKey: GVYATPKTSSTHKN-ZIAGYGMSSA-N.
| Molecular formula | C16H24N2O3 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | GVYATPKTSSTHKN-ZIAGYGMSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)