cas: 1260794-50-0 — see every product listed under this CAS number, including other names
TERT-BUTYL 5-FLUOROPYRIDIN-2-YLCARBAMATE, ≥97%, ≥97% (CAS 1260794-50-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RAY-100mg |
| cas | 1260794-50-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1154.00 Pln | |
| Chemat | 5g | 2334.80 Pln | |
| Chemat | 10g | 3472.40 Pln | |
| Chemat | 25g | 6885.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-fluoro-2-pyridinyl)carbamate (CAS 1260794-50-0) is a chemical compound with the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. IUPAC name: tert-butyl N-(5-fluoro-2-pyridinyl)carbamate. InChIKey: QJKDSHHDJJUUNY-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O2 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | tert-butyl N-(5-fluoro-2-pyridinyl)carbamate |
| InChIKey | QJKDSHHDJJUUNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=C1)F |
Computed by PubChem (NCBI)