cas: 1202800-68-7 — see every product listed under this CAS number, including other names
TERT-BUTYL 6,7-DIHYDRO-1H-IMIDAZO[4,5-C]PYRIDINE-5(4H)-CARBOXYLATE, 98% (CAS 1202800-68-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F469957-100MG |
| cas | 1202800-68-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 500mg | 383.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate (CAS 1202800-68-7) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl 3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate. InChIKey: DGOLMFKQDDOSPK-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl 3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
| InChIKey | DGOLMFKQDDOSPK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)NC=N2 |
Computed by PubChem (NCBI)