cas: 165894-06-4 — see every product listed under this CAS number, including other names
TERT-BUTYL 6,7-DIHYDROPYRAZOLO[1,5-A]PYRAZINE-5(4H)-CARBOXYLATE, 96% (CAS 165894-06-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513814-100MG |
| cas | 165894-06-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 737.26 Pln | |
| Fluorochem | 1g | 1851.45 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (CAS 165894-06-4) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl 6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate. InChIKey: DVXJIVBUWXAWHA-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl 6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| InChIKey | DVXJIVBUWXAWHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=CC=N2)C1 |
Computed by PubChem (NCBI)