cas: 748805-96-1 — see every product listed under this CAS number, including other names
TERT-BUTYL 6-METHYLENE-1,4-OXAZEPANE-4-CARBOXYLATE, 98% (CAS 748805-96-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303700-250MG |
| cas | 748805-96-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 500mg | 341.56 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1372.45 Pln | |
| Fluorochem | 10g | 2309.62 Pln | |
| Fluorochem | 25g | 5688.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 6-methylidene-1,4-oxazepane-4-carboxylate (CAS 748805-96-1) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 6-methylidene-1,4-oxazepane-4-carboxylate. InChIKey: UHNJPHHZWSDWHT-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 6-methylidene-1,4-oxazepane-4-carboxylate |
| InChIKey | UHNJPHHZWSDWHT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOCC(=C)C1 |
Computed by PubChem (NCBI)