Products 2883813-58-7
CAS 2883813-58-7 appears in our catalog under these names: TGFβ1-IN-3/ 99.47% (existing batch purity), TGFβ1-IN-3. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-4-(6-piperidin-1-ylhexoxy)benzamide (CAS 2883813-58-7) is a chemical compound with the molecular formula C23H30N4O5 and a molecular weight of 442.5 g/mol. IUPAC name: N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-4-(6-piperidin-1-ylhexoxy)benzamide. InChIKey: BIJZSBWAQJBCDA-HKOYGPOVSA-N.
| Molecular formula | C23H30N4O5 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-4-(6-piperidin-1-ylhexoxy)benzamide |
| InChIKey | BIJZSBWAQJBCDA-HKOYGPOVSA-N |
| SMILES | C1CCN(CC1)CCCCCCOC2=CC=C(C=C2)C(=O)N/N=C/C3=CC=C(O3)[N+](=O)[O-] |
Computed by PubChem (NCBI)