CAS 2763602-67-9 appears in our catalog under these names: TGFβRI-IN-3/ 98.02% (existing batch purity), TGFβRI–IN–3, TGFβRI-IN-3 98%, 7-(4-(Methylsulfonyl)phenyl)-N-(2-(m-tolyl)pyridin-4-yl)quinolin-4-amine, 98%, 98%, TGFβRI-IN-3, 98.21%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 100 mg.
N-[2-(3-methylphenyl)-4-pyridinyl]-7-(4-methylsulfonylphenyl)quinolin-4-amine (CAS 2763602-67-9) is a chemical compound with the molecular formula C28H23N3O2S and a molecular weight of 465.6 g/mol. IUPAC name: N-[2-(3-methylphenyl)-4-pyridinyl]-7-(4-methylsulfonylphenyl)quinolin-4-amine. InChIKey: VYDDFPZEAIUBBH-UHFFFAOYSA-N.
| Molecular formula | C28H23N3O2S |
|---|---|
| Molecular weight | 465.6 g/mol |
| IUPAC name | N-[2-(3-methylphenyl)-4-pyridinyl]-7-(4-methylsulfonylphenyl)quinolin-4-amine |
| InChIKey | VYDDFPZEAIUBBH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC=CC(=C2)NC3=C4C=CC(=CC4=NC=C3)C5=CC=C(C=C5)S(=O)(=O)C |
Computed by PubChem (NCBI)