CAS 16752-89-9 appears in our catalog under these names: TGP-377/421/ 98.48% (existing batch purity), TGP–377/421, 2,2'-(1,3-Phenylene)bis(1H-benzo[d]imidazol-6-amine), TGP-377/421, 98.17%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM * 1mlindmso.
2-[3-(6-amino-1H-benzimidazol-2-yl)phenyl]-3H-benzimidazol-5-amine (CAS 16752-89-9) is a chemical compound with the molecular formula C20H16N6 and a molecular weight of 340.4 g/mol. IUPAC name: 2-[3-(6-amino-1H-benzimidazol-2-yl)phenyl]-3H-benzimidazol-5-amine. InChIKey: AQEJANNNADGRSY-UHFFFAOYSA-N.
| Molecular formula | C20H16N6 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-[3-(6-amino-1H-benzimidazol-2-yl)phenyl]-3H-benzimidazol-5-amine |
| InChIKey | AQEJANNNADGRSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC3=C(N2)C=C(C=C3)N)C4=NC5=C(N4)C=C(C=C5)N |
Computed by PubChem (NCBI)