Products 313520-94-4
CAS 313520-94-4 appears in our catalog under these names: TH-263/ 99.33% (existing batch purity), TH263, TH 263, TH-263, TH-263, 99.0%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25 mg.
N-benzyl-4-(benzylsulfamoyl)benzamide (CAS 313520-94-4) is a chemical compound with the molecular formula C21H20N2O3S and a molecular weight of 380.5 g/mol. IUPAC name: N-benzyl-4-(benzylsulfamoyl)benzamide. InChIKey: QDGVJMITKNOVTP-UHFFFAOYSA-N.
| Molecular formula | C21H20N2O3S |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | N-benzyl-4-(benzylsulfamoyl)benzamide |
| InChIKey | QDGVJMITKNOVTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC=C(C=C2)S(=O)(=O)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)