CAS 1609960-31-7 appears in our catalog under these names: TH588/ 99.57% (existing batch purity), TH588, TH588 99%, TH588, 99%, 99%, TH588, 99.20%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
4-N-cyclopropyl-6-(2,3-dichlorophenyl)pyrimidine-2,4-diamine (CAS 1609960-31-7) is a chemical compound with the molecular formula C13H12Cl2N4 and a molecular weight of 295.16 g/mol. IUPAC name: 4-N-cyclopropyl-6-(2,3-dichlorophenyl)pyrimidine-2,4-diamine. InChIKey: PNMYJIOQIAEYQL-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N4 |
|---|---|
| Molecular weight | 295.16 g/mol |
| IUPAC name | 4-N-cyclopropyl-6-(2,3-dichlorophenyl)pyrimidine-2,4-diamine |
| InChIKey | PNMYJIOQIAEYQL-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=NC(=NC(=C2)C3=C(C(=CC=C3)Cl)Cl)N |
Computed by PubChem (NCBI)