CAS 606932-81-4 appears in our catalog under these names: THR-0921/ 98.53% (existing batch purity), THR-0921, (E)-CLX-0921, 98.17%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 1mg, 5mg, 10mg, 5 mg, 1 mg.
Methyl (E)-3-(3,5-dimethoxyphenyl)-2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]prop-2-enoate (CAS 606932-81-4) is a chemical compound with the molecular formula C28H25NO7S and a molecular weight of 519.6 g/mol. IUPAC name: methyl (E)-3-(3,5-dimethoxyphenyl)-2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]prop-2-enoate. InChIKey: IVAQJHSXBVHUQT-ZVHZXABRSA-N.
| Molecular formula | C28H25NO7S |
|---|---|
| Molecular weight | 519.6 g/mol |
| IUPAC name | methyl (E)-3-(3,5-dimethoxyphenyl)-2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]prop-2-enoate |
| InChIKey | IVAQJHSXBVHUQT-ZVHZXABRSA-N |
| SMILES | COC1=CC(=CC(=C1)/C=C(\C2=CC=C(C=C2)OC3=CC=C(C=C3)CC4C(=O)NC(=O)S4)/C(=O)OC)OC |
Computed by PubChem (NCBI)