CAS 1620820-12-3 appears in our catalog under these names: TL4–12, TL4-12, TL4-12, 99.82%, TL4-12, 98%, 98%, TL4-12/ 98.38% (existing batch purity). Offered by: GLPBio, Biosynth, MedChemExpress, Chemat, TargetMol. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 100mg, 50mg, 5 mg, 10 mg.
4-methyl-3-[6-(methylamino)pyrimidin-4-yl]oxy-N-[3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide (CAS 1620820-12-3) is a chemical compound with the molecular formula C25H27F3N6O2 and a molecular weight of 500.5 g/mol. IUPAC name: 4-methyl-3-[6-(methylamino)pyrimidin-4-yl]oxy-N-[3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide. InChIKey: HXKJJIMUMNPQQY-UHFFFAOYSA-N.
| Molecular formula | C25H27F3N6O2 |
|---|---|
| Molecular weight | 500.5 g/mol |
| IUPAC name | 4-methyl-3-[6-(methylamino)pyrimidin-4-yl]oxy-N-[3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
| InChIKey | HXKJJIMUMNPQQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=CC(=CC(=C2)C(F)(F)F)N3CCN(CC3)C)OC4=NC=NC(=C4)NC |
Computed by PubChem (NCBI)