CAS 1279713-77-7 appears in our catalog under these names: TLR3-IN-1/ 97.77% (existing batch purity), CU CPT 4a, CU CPT 4a, CU-CPT 4a 99%, (3-Chloro-6-fluorobenzo[b]thiophene-2-carbonyl)-D-phenylalanine, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(2R)-2-[(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino]-3-phenylpropanoic acid (CAS 1279713-77-7) is a chemical compound with the molecular formula C18H13ClFNO3S and a molecular weight of 377.8 g/mol. IUPAC name: (2R)-2-[(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino]-3-phenylpropanoic acid. InChIKey: IAASQMCXDRISAV-CYBMUJFWSA-N.
| Molecular formula | C18H13ClFNO3S |
|---|---|
| Molecular weight | 377.8 g/mol |
| IUPAC name | (2R)-2-[(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino]-3-phenylpropanoic acid |
| InChIKey | IAASQMCXDRISAV-CYBMUJFWSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)C2=C(C3=C(S2)C=C(C=C3)F)Cl |
Computed by PubChem (NCBI)