CAS 1258457-59-8 appears in our catalog under these names: TLR7/8 agonist 1, TLR7/8 agonist 1, TLR7/8 Agonist 1 98%, TLR7/8 agonist 1, 98.42%, 1-[[4-(Aminomethyl)phenyl]methyl]-2-butyl-1H-imidazo[4,5-c]quinolin-4-amine, 98%, 98%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 250mg.
1-[[4-(aminomethyl)phenyl]methyl]-2-butylimidazo[4,5-c]quinolin-4-amine (CAS 1258457-59-8) is a chemical compound with the molecular formula C22H25N5 and a molecular weight of 359.5 g/mol. IUPAC name: 1-[[4-(aminomethyl)phenyl]methyl]-2-butylimidazo[4,5-c]quinolin-4-amine. InChIKey: SDSKFWHQCNBICO-UHFFFAOYSA-N.
| Molecular formula | C22H25N5 |
|---|---|
| Molecular weight | 359.5 g/mol |
| IUPAC name | 1-[[4-(aminomethyl)phenyl]methyl]-2-butylimidazo[4,5-c]quinolin-4-amine |
| InChIKey | SDSKFWHQCNBICO-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(N1CC3=CC=C(C=C3)CN)C4=CC=CC=C4N=C2N |
Computed by PubChem (NCBI)