CAS 2388520-33-8 appears in our catalog under these names: TLR7/8 agonist 4, TLR7/8 agonist 4, 99.18%, TLR7/8 agonist 4, 99.04%, 99.04%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 250 mg, 50 mg, 10mM/1mL, 500 mg, 100 mg, 5 mg, 10 mg.
2-butyl-8-piperazin-1-yl-3H-imidazo[4,5-c]quinolin-4-amine (CAS 2388520-33-8) is a chemical compound with the molecular formula C18H24N6 and a molecular weight of 324.4 g/mol. IUPAC name: 2-butyl-8-piperazin-1-yl-3H-imidazo[4,5-c]quinolin-4-amine. InChIKey: SPPYNUDMEQYSPQ-UHFFFAOYSA-N.
| Molecular formula | C18H24N6 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 2-butyl-8-piperazin-1-yl-3H-imidazo[4,5-c]quinolin-4-amine |
| InChIKey | SPPYNUDMEQYSPQ-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(N1)C(=NC3=C2C=C(C=C3)N4CCNCC4)N |
Computed by PubChem (NCBI)