Products 1103926-82-4
CAS 1103926-82-4 appears in our catalog under these names: TM5275 sodium/ 99.55% (existing batch purity), TM5275 sodium, TM5275 sodium, TM5275 sodium, 98%, 98%, TM5275 (sodium), 98.97%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Sodium 2-[[2-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethoxy]acetyl]amino]-5-chlorobenzoate (CAS 1103926-82-4) is a chemical compound with the molecular formula C28H27ClN3NaO5 and a molecular weight of 544.0 g/mol. IUPAC name: sodium 2-[[2-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethoxy]acetyl]amino]-5-chlorobenzoate. InChIKey: JSHSGBIWNPQCQZ-UHFFFAOYSA-M.
| Molecular formula | C28H27ClN3NaO5 |
|---|---|
| Molecular weight | 544.0 g/mol |
| IUPAC name | sodium 2-[[2-[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethoxy]acetyl]amino]-5-chlorobenzoate |
| InChIKey | JSHSGBIWNPQCQZ-UHFFFAOYSA-M |
| SMILES | C1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)COCC(=O)NC4=C(C=C(C=C4)Cl)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)