Products 2760481-53-4
CAS 2760481-53-4 appears in our catalog under these names: TNG908/ 99.79% (existing batch purity), TNG908, TNG908 99%, TNG908, 99%, 99%, Ralometostat, 99.90%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10mM/1mL.
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetamide (CAS 2760481-53-4) is a chemical compound with the molecular formula C21H23N5O2S and a molecular weight of 409.5 g/mol. IUPAC name: N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetamide. InChIKey: NXXBDYHMHHINFC-YVEFUNNKSA-N.
| Molecular formula | C21H23N5O2S |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-(1,3-benzothiazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
| InChIKey | NXXBDYHMHHINFC-YVEFUNNKSA-N |
| SMILES | C[C@H]1CC[C@@H](N(C1)C(=O)C(=O)NC2=CN=C(C(=C2)C)N)C3=CC4=C(C=C3)SC=N4 |
Computed by PubChem (NCBI)