CAS 2754265-66-0 appears in our catalog under these names: TNIK-IN-5/ 99.75% (existing batch purity), TNIK-IN-5, TNIK-IN-5, 99.75%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
3-[(3-methoxyphenyl)methyl]-6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1,3-benzoxazol-2-one (CAS 2754265-66-0) is a chemical compound with the molecular formula C22H17N3O3 and a molecular weight of 371.4 g/mol. IUPAC name: 3-[(3-methoxyphenyl)methyl]-6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1,3-benzoxazol-2-one. InChIKey: DRHILHIKLGEWOH-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O3 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 3-[(3-methoxyphenyl)methyl]-6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1,3-benzoxazol-2-one |
| InChIKey | DRHILHIKLGEWOH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CN2C3=C(C=C(C=C3)C4=CN=C5C(=C4)C=CN5)OC2=O |
Computed by PubChem (NCBI)