CAS 519178-28-0 appears in our catalog under these names: TNP/ 98.25% (existing batch purity), TNP, IP6K Inhibitor 1PC X 5MG, N6-(4-Nitrobenzyl)-N2-(3-(trifluoromethyl)benzyl)-9H-purine-2,6-diamine, 97%, 97%, TNP, 98.04%. Offered by: TargetMol, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 5 mg.
6-N-[(4-nitrophenyl)methyl]-2-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purine-2,6-diamine (CAS 519178-28-0) is a chemical compound with the molecular formula C20H16F3N7O2 and a molecular weight of 443.4 g/mol. IUPAC name: 6-N-[(4-nitrophenyl)methyl]-2-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purine-2,6-diamine. InChIKey: DDSBPUYZPWNNGH-UHFFFAOYSA-N.
| Molecular formula | C20H16F3N7O2 |
|---|---|
| Molecular weight | 443.4 g/mol |
| IUPAC name | 6-N-[(4-nitrophenyl)methyl]-2-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purine-2,6-diamine |
| InChIKey | DDSBPUYZPWNNGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CNC2=NC3=C(C(=N2)NCC4=CC=C(C=C4)[N+](=O)[O-])NC=N3 |
Computed by PubChem (NCBI)