CAS 898563-00-3 appears in our catalog under these names: TP-10/ 98.48% (existing batch purity), TP–10, TP-10, TP-10, 99.95%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
2-[[4-[4-pyridin-4-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]phenoxy]methyl]quinoline (CAS 898563-00-3) is a chemical compound with the molecular formula C26H19F3N4O and a molecular weight of 460.4 g/mol. IUPAC name: 2-[[4-[4-pyridin-4-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]phenoxy]methyl]quinoline. InChIKey: NOIXNOMHHWGUTG-UHFFFAOYSA-N.
| Molecular formula | C26H19F3N4O |
|---|---|
| Molecular weight | 460.4 g/mol |
| IUPAC name | 2-[[4-[4-pyridin-4-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]phenoxy]methyl]quinoline |
| InChIKey | NOIXNOMHHWGUTG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)COC3=CC=C(C=C3)C4=NN(C=C4C5=CC=NC=C5)CC(F)(F)F |
Computed by PubChem (NCBI)