Products 21306-65-0

CAS 21306-65-0 appears in our catalog under these names: Triphenyl Compound A, TPh A, TPh A/ 99.81% (existing batch purity), TPh A, 98.00%, TPh A, ≥98%, ≥98%. Offered by: TRC, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 50mg, 10mg, 100mg, 25mg, 5mg, 1mg, 10mM/1mL, 10 mg.

Structural formula: {0} (CAS {1})

4-methyl-N-[methyl-(4-phenylmethoxyphenyl)-lambda4-sulfanylidene]benzenesulfonamide (CAS 21306-65-0) is a chemical compound with the molecular formula C21H21NO3S2 and a molecular weight of 399.5 g/mol. IUPAC name: 4-methyl-N-[methyl-(4-phenylmethoxyphenyl)-lambda4-sulfanylidene]benzenesulfonamide. InChIKey: IMUPOWQOXOCVBN-UHFFFAOYSA-N.

Identity
Molecular formulaC21H21NO3S2
Molecular weight399.5 g/mol
IUPAC name4-methyl-N-[methyl-(4-phenylmethoxyphenyl)-lambda4-sulfanylidene]benzenesulfonamide
InChIKeyIMUPOWQOXOCVBN-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N=S(C)C2=CC=C(C=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)