CAS 353483-92-8 appears in our catalog under these names: TQS, TQS/ 99.16% (existing batch purity), TQS 99%, TQS, 95%, 95%, TQS, 99.84%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg, 250mg.
4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (CAS 353483-92-8) is a chemical compound with the molecular formula C22H20N2O2S and a molecular weight of 376.5 g/mol. IUPAC name: 4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide. InChIKey: SIZWDJIHABLBSP-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O2S |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | 4-naphthalen-1-yl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| InChIKey | SIZWDJIHABLBSP-UHFFFAOYSA-N |
| SMILES | C1C=CC2C1C(NC3=C2C=C(C=C3)S(=O)(=O)N)C4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)