cas: 1956380-68-9 — see every product listed under this CAS number, including other names
TRANS-METHYL 4-(4-BROMOPHENYL)PYRROLIDINE-3-CARBOXYLATE HCL, 95% (CAS 1956380-68-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F389921-250MG |
| cas | 1956380-68-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1174.60 Pln | |
| Fluorochem | 1g | 2752.17 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (3R,4S)-4-(4-bromophenyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 1956380-68-9) is a chemical compound with the molecular formula C12H15BrClNO2 and a molecular weight of 320.61 g/mol. IUPAC name: methyl (3R,4S)-4-(4-bromophenyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: SFNPHXYXUPRECO-DHXVBOOMSA-N.
| Molecular formula | C12H15BrClNO2 |
|---|---|
| Molecular weight | 320.61 g/mol |
| IUPAC name | methyl (3R,4S)-4-(4-bromophenyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | SFNPHXYXUPRECO-DHXVBOOMSA-N |
| SMILES | COC(=O)[C@H]1CNC[C@@H]1C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)