CAS 351424-20-9 appears in our catalog under these names: CBA, TRPM4-IN-1/ 98.75% (existing batch purity), 4-Chloro-2-[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid, 98%, 98%, TRPM4-IN-1, 99.98%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 200mg, 250mg.
4-chloro-2-[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid (CAS 351424-20-9) is a chemical compound with the molecular formula C15H11Cl2NO4 and a molecular weight of 340.2 g/mol. IUPAC name: 4-chloro-2-[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid. InChIKey: CVQCJPCMPGKEDH-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO4 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 4-chloro-2-[[2-(2-chlorophenoxy)acetyl]amino]benzoic acid |
| InChIKey | CVQCJPCMPGKEDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC(=O)NC2=C(C=CC(=C2)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)