Products 207972-39-2
CAS 207972-39-2 appears in our catalog under these names: Nonanedioic acid,1,9-bis[2-(ethoxycarbonyl)phenyl] ester, TU-2100/ 98.07% (existing batch purity), TU-2100. Offered by: Chemat, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
Bis(2-ethoxycarbonylphenyl) nonanedioate (CAS 207972-39-2) is a chemical compound with the molecular formula C27H32O8 and a molecular weight of 484.5 g/mol. IUPAC name: bis(2-ethoxycarbonylphenyl) nonanedioate. InChIKey: LIBAUACOIKWWKP-UHFFFAOYSA-N.
| Molecular formula | C27H32O8 |
|---|---|
| Molecular weight | 484.5 g/mol |
| IUPAC name | bis(2-ethoxycarbonylphenyl) nonanedioate |
| InChIKey | LIBAUACOIKWWKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC=C1OC(=O)CCCCCCCC(=O)OC2=CC=CC=C2C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Azeloyl diethyl salicylate, Azasal-2100, Bis(2-ethoxycarbonylphenyl) Nonanedioate, Azeloyl diethyl salicylate [INCI], Nonanedioic acid, bis(2-(ethoxycarbonyl)phenyl) ester, Nonanedioic acid, 1,9-bis(2-(ethoxycarbonyl)phenyl) ester, Nonanedioic acid, 1,9-bis[2-(ethoxycarbonyl)phenyl] ester, bis(2-(ethoxycarbonyl)phenyl) nonanedioate, orb1699089, di2-(ethoxycarbonyl)phenyl nonane-1,9-dioate