CAS 1402601-82-4 appears in our catalog under these names: TUG-770/ 97.6% (existing batch purity), TUG–770, TUG-770, 99.07%, TUG-770, 98%, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
3-[4-[2-[2-(cyanomethyl)phenyl]ethynyl]-2-fluorophenyl]propanoic acid (CAS 1402601-82-4) is a chemical compound with the molecular formula C19H14FNO2 and a molecular weight of 307.3 g/mol. IUPAC name: 3-[4-[2-[2-(cyanomethyl)phenyl]ethynyl]-2-fluorophenyl]propanoic acid. InChIKey: KIZUBVPJNPVIIN-UHFFFAOYSA-N.
| Molecular formula | C19H14FNO2 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 3-[4-[2-[2-(cyanomethyl)phenyl]ethynyl]-2-fluorophenyl]propanoic acid |
| InChIKey | KIZUBVPJNPVIIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC#N)C#CC2=CC(=C(C=C2)CCC(=O)O)F |
Computed by PubChem (NCBI)