CAS 1374516-07-0 appears in our catalog under these names: TUG 891, TUG-891/ 99.21% (existing batch purity), TUG 891, TUG-891, TUG-891 95%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
3-[4-[[5-fluoro-2-(4-methylphenyl)phenyl]methoxy]phenyl]propanoic acid (CAS 1374516-07-0) is a chemical compound with the molecular formula C23H21FO3 and a molecular weight of 364.4 g/mol. IUPAC name: 3-[4-[[5-fluoro-2-(4-methylphenyl)phenyl]methoxy]phenyl]propanoic acid. InChIKey: LPGBXHWIQNZEJB-UHFFFAOYSA-N.
| Molecular formula | C23H21FO3 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 3-[4-[[5-fluoro-2-(4-methylphenyl)phenyl]methoxy]phenyl]propanoic acid |
| InChIKey | LPGBXHWIQNZEJB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=C(C=C2)F)COC3=CC=C(C=C3)CCC(=O)O |
Computed by PubChem (NCBI)