CAS 603987-59-3 appears in our catalog under these names: TY-51469/ 98.89% (existing batch purity), TY–51469, TY 51469, TY-51469 98%, TY-51469, 99.65% ,, 99.65% ,. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 200mg.
2-[4-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-3-methylsulfonylphenyl]-1,3-thiazole-4-carboxylic acid (CAS 603987-59-3) is a chemical compound with the molecular formula C20H15FN2O6S4 and a molecular weight of 526.6 g/mol. IUPAC name: 2-[4-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-3-methylsulfonylphenyl]-1,3-thiazole-4-carboxylic acid. InChIKey: CBRCULCCRGSSLB-UHFFFAOYSA-N.
| Molecular formula | C20H15FN2O6S4 |
|---|---|
| Molecular weight | 526.6 g/mol |
| IUPAC name | 2-[4-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)sulfonylamino]-3-methylsulfonylphenyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | CBRCULCCRGSSLB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=C(C=C2)F)S(=O)(=O)NC3=C(C=C(C=C3)C4=NC(=CS4)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)