CAS 1505515-69-4 appears in our catalog under these names: Taletrectinib Adipate, Taletrectinib, Taletrectinib/ 99.96% (existing batch purity), Taletrectinib 99%, DS-6051b, 99%, 99%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 5mg, 1mg, 2mg, 25mg, 50mg.
3-[4-[(2R)-2-aminopropoxy]phenyl]-N-[(1R)-1-(3-fluorophenyl)ethyl]imidazo[1,2-b]pyridazin-6-amine;hexanedioic acid (CAS 1505515-69-4) is a chemical compound with the molecular formula C29H34FN5O5 and a molecular weight of 551.6 g/mol. IUPAC name: 3-[4-[(2R)-2-aminopropoxy]phenyl]-N-[(1R)-1-(3-fluorophenyl)ethyl]imidazo[1,2-b]pyridazin-6-amine;hexanedioic acid. InChIKey: DORJQZDOULKINH-QNBGGDODSA-N.
| Molecular formula | C29H34FN5O5 |
|---|---|
| Molecular weight | 551.6 g/mol |
| IUPAC name | 3-[4-[(2R)-2-aminopropoxy]phenyl]-N-[(1R)-1-(3-fluorophenyl)ethyl]imidazo[1,2-b]pyridazin-6-amine;hexanedioic acid |
| InChIKey | DORJQZDOULKINH-QNBGGDODSA-N |
| SMILES | C[C@H](COC1=CC=C(C=C1)C2=CN=C3N2N=C(C=C3)N[C@H](C)C4=CC(=CC=C4)F)N.C(CCC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)