CAS 67489-39-8 appears in our catalog under these names: Talmetacin, Talmetacin/ 99.83% (existing batch purity). Offered by: TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 50 mg.
(3-oxo-1H-2-benzofuran-1-yl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 67489-39-8) is a chemical compound with the molecular formula C27H20ClNO6 and a molecular weight of 489.9 g/mol. IUPAC name: (3-oxo-1H-2-benzofuran-1-yl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: XYRIRLDHOQSNLW-UHFFFAOYSA-N.
| Molecular formula | C27H20ClNO6 |
|---|---|
| Molecular weight | 489.9 g/mol |
| IUPAC name | (3-oxo-1H-2-benzofuran-1-yl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | XYRIRLDHOQSNLW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OC4C5=CC=CC=C5C(=O)O4 |
Computed by PubChem (NCBI)