CAS 69659-80-9 appears in our catalog under these names: Sodium 1,6,6-Trimethyl-10,11-dioxo-6,7,8,9,10,11-hexahydrophenanthro(1,2-b)furan-2-sulfonate, Tanshinone IIA sulfonate sodium, Tanshinone IIA sulfonate sodium/ 99.9%, Sodium tanshinone IIA sulfonate, Phenanthro[1,2-b]furan-2-sulfonic acid, 6,7,8,9,10,11-hexahydro-1,6,6-trimethyl-10,11-dioxo-, sodium salt (1:1), 98%, 98%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 500mg, 250mg, 1000mg, 2000mg.
Sodium 1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-sulfonate (CAS 69659-80-9) is a chemical compound with the molecular formula C19H17NaO6S and a molecular weight of 396.4 g/mol. IUPAC name: sodium 1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-sulfonate. InChIKey: AZEZEAABTDXEHR-UHFFFAOYSA-M.
| Molecular formula | C19H17NaO6S |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | sodium 1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-sulfonate |
| InChIKey | AZEZEAABTDXEHR-UHFFFAOYSA-M |
| SMILES | CC1=C(OC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)