CAS 1643489-24-0 appears in our catalog under these names: Tavapadon/ 99.8% (existing batch purity), PF–06649751, Tavapadon, Tavapadon 97%, Tavapadon, 97%, 97%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
1,5-dimethyl-6-[2-methyl-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyrimidine-2,4-dione (CAS 1643489-24-0) is a chemical compound with the molecular formula C19H16F3N3O3 and a molecular weight of 391.3 g/mol. IUPAC name: 1,5-dimethyl-6-[2-methyl-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyrimidine-2,4-dione. InChIKey: AKQXQLUNFKDZBN-UHFFFAOYSA-N.
| Molecular formula | C19H16F3N3O3 |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | 1,5-dimethyl-6-[2-methyl-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyrimidine-2,4-dione |
| InChIKey | AKQXQLUNFKDZBN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=C(C=CC=N2)C(F)(F)F)C3=C(C(=O)NC(=O)N3C)C |
Computed by PubChem (NCBI)