Products 1893397-65-3
CAS 1893397-65-3 appears in our catalog under these names: Tbk1/ikkepsilon-in-5, 95%, TBK1/IKKε-IN-5/ 99.93% (existing batch purity), Tbk1/ikkε-in-5, TBK1/IKKε-IN-5, 98%, 98%, TBK1/IKKε-IN-5, 99.96%. Offered by: Combi-blocks, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg.
2-(oxan-4-yloxy)-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (CAS 1893397-65-3) is a chemical compound with the molecular formula C28H31N7O3 and a molecular weight of 513.6 g/mol. IUPAC name: 2-(oxan-4-yloxy)-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile. InChIKey: QYQFLAQHGHBIFA-UHFFFAOYSA-N.
| Molecular formula | C28H31N7O3 |
|---|---|
| Molecular weight | 513.6 g/mol |
| IUPAC name | 2-(oxan-4-yloxy)-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| InChIKey | QYQFLAQHGHBIFA-UHFFFAOYSA-N |
| SMILES | C1COCCC1OC2=C(C=C(C=C2)C3=NC(=NC=N3)NC4=CC=C(C=C4)N5CCN(CC5)C6COC6)C#N |
Computed by PubChem (NCBI)