CAS 887936-68-7 appears in our catalog under these names: Temanogrel/ 98.74% (existing batch purity), Temanogrel (APD791), Temanogrel 97%, 3-Methoxy-N-[3-(1-methyl-1H-pyrazol-5-yl)-4-[2-(4-morpholinyl)ethoxy]phenyl]benzamide, 97%, 97%, Temanogrel (Standard). Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
3-methoxy-N-[3-(2-methylpyrazol-3-yl)-4-(2-morpholin-4-ylethoxy)phenyl]benzamide;hydrochloride (CAS 887936-68-7) is a chemical compound with the molecular formula C24H29ClN4O4 and a molecular weight of 473.0 g/mol. IUPAC name: 3-methoxy-N-[3-(2-methylpyrazol-3-yl)-4-(2-morpholin-4-ylethoxy)phenyl]benzamide;hydrochloride. InChIKey: APWHJJLFCMBWQT-UHFFFAOYSA-N.
| Molecular formula | C24H29ClN4O4 |
|---|---|
| Molecular weight | 473.0 g/mol |
| IUPAC name | 3-methoxy-N-[3-(2-methylpyrazol-3-yl)-4-(2-morpholin-4-ylethoxy)phenyl]benzamide;hydrochloride |
| InChIKey | APWHJJLFCMBWQT-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=C(C=CC(=C2)NC(=O)C3=CC(=CC=C3)OC)OCCN4CCOCC4.Cl |
Computed by PubChem (NCBI)