cas: 412293-62-0 — see every product listed under this CAS number, including other names
Tert-Butyl (cis-4-hydroxy-1-methylcyclohexyl)carbamate, 97%, 97% (CAS 412293-62-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I93D-100mg |
| cas | 412293-62-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1134.80 Pln | |
| Chemat | 250mg | 1907.60 Pln | |
| Chemat | 1g | 4437.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4-hydroxy-1-methylcyclohexyl)carbamate (CAS 412293-62-0) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl N-(4-hydroxy-1-methylcyclohexyl)carbamate. InChIKey: JJAVBBNDEUQQSR-UHFFFAOYSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl N-(4-hydroxy-1-methylcyclohexyl)carbamate |
| InChIKey | JJAVBBNDEUQQSR-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)