CAS 213672-64-1 appears in our catalog under these names: Cis-(2-hydroxymethyl-cyclohexyl)-carbamic acid tert-butyl ester, 95%, rel-1,1-Dimethylethyl N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]carbamate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g.
Tert-butyl N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]carbamate (CAS 213672-64-1) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]carbamate. InChIKey: XUFBETUUQRMWRY-NXEZZACHSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]carbamate |
| InChIKey | XUFBETUUQRMWRY-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@@H]1CO |
Computed by PubChem (NCBI)