cas: 147291-66-5 — see every product listed under this CAS number, including other names
Tert-Butyl 3-aminobenzylcarbamate, 98%, 98% (CAS 147291-66-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ERN-100mg |
| cas | 147291-66-5 |
| size | 100mg |
| availability | 39g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 693.20 Pln | |
| Chemat | 10g | 1322.00 Pln | |
| Chemat | 25g | 3050.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3-aminophenyl)methyl]carbamate (CAS 147291-66-5) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: tert-butyl N-[(3-aminophenyl)methyl]carbamate. InChIKey: LSOZALWRNWQPLK-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | tert-butyl N-[(3-aminophenyl)methyl]carbamate |
| InChIKey | LSOZALWRNWQPLK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=CC=C1)N |
Computed by PubChem (NCBI)