Tert-Butyl Indoline-2-Carboxylate, 95%
cas: 1218501-71-3 — see every product listed under this CAS number, including other names
Tert-Butyl Indoline-2-Carboxylate, 95% (CAS 1218501-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg, 500mg, 2.5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12AE5L-100mg |
| cas | 1218501-71-3 |
| size | 100mg |
| availability | 3g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 880.40 Pln | |
| Chemat | 250mg | 1427.60 Pln | |
| Chemat | 1g | 2795.60 Pln | |
| Fluorochem | 50mg | 773.70 Pln | |
| Fluorochem | 100mg | 1216.26 Pln | |
| Fluorochem | 250mg | 1992.02 Pln | |
| Fluorochem | 500mg | 2247.14 Pln | |
| Fluorochem | 1g | 2965.64 Pln | |
| Fluorochem | 2.5g | 7115.22 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,3-dihydro-1H-indole-2-carboxylate (CAS 1218501-71-3) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: tert-butyl 2,3-dihydro-1H-indole-2-carboxylate. InChIKey: BWLRZKYMVHFPLH-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | tert-butyl 2,3-dihydro-1H-indole-2-carboxylate |
| InChIKey | BWLRZKYMVHFPLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)