cas: 2812-46-6 — see every product listed under this CAS number, including other names
Tert-Butyl L-prolinate, 98%, 98% (CAS 2812-46-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UKS-1g |
| cas | 2812-46-6 |
| size | 1g |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 208.40 Pln | |
| Chemat | 100g | 602.00 Pln | |
| Chemat | 500g | 2688.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-pyrrolidine-2-carboxylate (CAS 2812-46-6) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: tert-butyl (2S)-pyrrolidine-2-carboxylate. InChIKey: XJJBXZIKXFOMLP-ZETCQYMHSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | tert-butyl (2S)-pyrrolidine-2-carboxylate |
| InChIKey | XJJBXZIKXFOMLP-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1 |
Computed by PubChem (NCBI)