CAS 2812-46-6 appears in our catalog under these names: L-Proline tert-Butyl Ester, H–Pro–OtBu, L-Proline tert-butyl ester, 98% , L-Proline tert-butyl ester, 98.00%, H-Pro-OtBu 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 2,5g, 25g, 5g, 1g, 10g, 50g, 100g, 500g.
Tert-butyl (2S)-pyrrolidine-2-carboxylate (CAS 2812-46-6) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: tert-butyl (2S)-pyrrolidine-2-carboxylate. InChIKey: XJJBXZIKXFOMLP-ZETCQYMHSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | tert-butyl (2S)-pyrrolidine-2-carboxylate |
| InChIKey | XJJBXZIKXFOMLP-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1 |
Computed by PubChem (NCBI)