cas: 1425335-44-9 — see every product listed under this CAS number, including other names
Tert-butyl 4-((4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)piperidine-1-carboxylate, 95%, 95% (CAS 1425335-44-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HWIH-250mg |
| cas | 1425335-44-9 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 1869.20 Pln | |
| Chemat | 10g | 3674.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]piperidine-1-carboxylate (CAS 1425335-44-9) is a chemical compound with the molecular formula C17H32BNO4 and a molecular weight of 325.3 g/mol. IUPAC name: tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]piperidine-1-carboxylate. InChIKey: QMQDGWLWXYJXGH-UHFFFAOYSA-N.
| Molecular formula | C17H32BNO4 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]piperidine-1-carboxylate |
| InChIKey | QMQDGWLWXYJXGH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)