cas: 1425335-44-9 — see every product listed under this CAS number, including other names
Tert-butyl 4-((4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)piperidine-1-carboxylate, 98% (CAS 1425335-44-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694163-50MG |
| cas | 1425335-44-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 159.34 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 5g | 2632.42 Pln | |
| Fluorochem | 10g | 5183.61 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]piperidine-1-carboxylate (CAS 1425335-44-9) is a chemical compound with the molecular formula C17H32BNO4 and a molecular weight of 325.3 g/mol. IUPAC name: tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]piperidine-1-carboxylate. InChIKey: QMQDGWLWXYJXGH-UHFFFAOYSA-N.
| Molecular formula | C17H32BNO4 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | tert-butyl 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]piperidine-1-carboxylate |
| InChIKey | QMQDGWLWXYJXGH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)