cas: 1027616-32-5 — see every product listed under this CAS number, including other names
Tert-butyl 4-(5-iodopyrimidin-2-yl)piperazine-1-carboxylate, 98%, 98% (CAS 1027616-32-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120EQ6-500mg |
| cas | 1027616-32-5 |
| size | 500mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 155.60 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 501.20 Pln | |
| Chemat | 10g | 885.20 Pln | |
| Chemat | 25g | 1816.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(5-iodopyrimidin-2-yl)piperazine-1-carboxylate (CAS 1027616-32-5) is a chemical compound with the molecular formula C13H19IN4O2 and a molecular weight of 390.22 g/mol. IUPAC name: tert-butyl 4-(5-iodopyrimidin-2-yl)piperazine-1-carboxylate. InChIKey: QTVLKNKJZMNQKD-UHFFFAOYSA-N.
| Molecular formula | C13H19IN4O2 |
|---|---|
| Molecular weight | 390.22 g/mol |
| IUPAC name | tert-butyl 4-(5-iodopyrimidin-2-yl)piperazine-1-carboxylate |
| InChIKey | QTVLKNKJZMNQKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=N2)I |
Computed by PubChem (NCBI)