cas: 1027616-32-5 — see every product listed under this CAS number, including other names
tert-Butyl 4-(5-iodopyrimidin-2-yl)piperazine-1-carboxylate 98% (CAS 1027616-32-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A984556-1g |
| cas | 1027616-32-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 10g | 1193.62 Pln | |
| Ambeed | 25g | 2372.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A984556 |
Tert-butyl 4-(5-iodopyrimidin-2-yl)piperazine-1-carboxylate (CAS 1027616-32-5) is a chemical compound with the molecular formula C13H19IN4O2 and a molecular weight of 390.22 g/mol. IUPAC name: tert-butyl 4-(5-iodopyrimidin-2-yl)piperazine-1-carboxylate. InChIKey: QTVLKNKJZMNQKD-UHFFFAOYSA-N.
| Molecular formula | C13H19IN4O2 |
|---|---|
| Molecular weight | 390.22 g/mol |
| IUPAC name | tert-butyl 4-(5-iodopyrimidin-2-yl)piperazine-1-carboxylate |
| InChIKey | QTVLKNKJZMNQKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=N2)I |
Computed by PubChem (NCBI)