cas: 1883598-68-2 — see every product listed under this CAS number, including other names
Tert-butyl 5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 98%, 98% (CAS 1883598-68-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNMB-100mg |
| cas | 1883598-68-2 |
| size | 100mg |
| availability | 3.85g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 654.80 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 1504.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 1883598-68-2) is a chemical compound with the molecular formula C20H28BNO4 and a molecular weight of 357.3 g/mol. IUPAC name: tert-butyl 5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: VNYDSZKOZVVGTF-UHFFFAOYSA-N.
| Molecular formula | C20H28BNO4 |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | tert-butyl 5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | VNYDSZKOZVVGTF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=C(C=C3)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)